C32H36Cl2N2O6S — CID 18883933
2-[[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate (PubChem CID 18883933) has the molecular formula C32H36Cl2N2O6S and a molecular weight of 647.62 g/mol. Its IUPAC name is 2-[[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate.
| Compound Name | 2-[[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 18883933 |
| Molecular Formula | C32H36Cl2N2O6S |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | 2-[[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)Nc2sc3c(c2C(=O)NCCOC(=O)COc2cc(C)c(Cl)c(C)c2)CCC(C)C3)cc(C)c1Cl |
| InChI | InChI=1S/C32H36Cl2N2O6S/c1-17-6-7-24-25(10-17)43-32(36-26(37)15-41-22-11-18(2)29(33)19(3)12-22)28(24)31(39)35-8-9-40-27(38)16-42-23-13-20(4)30(34)21(5)14-23/h11-14,17H,6-10,15-16H2,1-5H3,(H,35,39)(H,36,37) |
| InChIKey | FXFPYIVEQMHHSH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|