C30H30Cl4N2O6S — CID 18883925
2-[[2-[(3,5-dichloro-4-ethoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 3,5-dichloro-4-ethoxybenzoate (PubChem CID 18883925) has the molecular formula C30H30Cl4N2O6S and a molecular weight of 688.46 g/mol. Its IUPAC name is 2-[[2-[(3,5-dichloro-4-ethoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | 2-[[2-[(3,5-dichloro-4-ethoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 18883925 |
| Molecular Formula | C30H30Cl4N2O6S |
| Molecular Weight | 688.46 g/mol |
| Exact Mass | 686.06 |
| IUPAC Name | 2-[[2-[(3,5-dichloro-4-ethoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2sc3c(c2C(=O)NCCOC(=O)c2cc(Cl)c(OCC)c(Cl)c2)CCC(C)C3)cc1Cl |
| InChI | InChI=1S/C30H30Cl4N2O6S/c1-4-40-25-19(31)11-16(12-20(25)32)27(37)36-29-24(18-7-6-15(3)10-23(18)43-29)28(38)35-8-9-42-30(39)17-13-21(33)26(41-5-2)22(34)14-17/h11-15H,4-10H2,1-3H3,(H,35,38)(H,36,37) |
| InChIKey | MTUVGMYUZMVHKT-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.46 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|