C21H32N2O5S — CID 18884463
2-(hydroxymethyl)-6-(1-octylbenzimidazol-2-yl)sulfanyloxane-3,4,5-triol (PubChem CID 18884463) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(1-octylbenzimidazol-2-yl)sulfanyloxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(1-octylbenzimidazol-2-yl)sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 18884463 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-(hydroxymethyl)-6-(1-octylbenzimidazol-2-yl)sulfanyloxane-3,4,5-triol |
| SMILES | CCCCCCCCn1c(SC2OC(CO)C(O)C(O)C2O)nc2ccccc21 |
| InChI | InChI=1S/C21H32N2O5S/c1-2-3-4-5-6-9-12-23-15-11-8-7-10-14(15)22-21(23)29-20-19(27)18(26)17(25)16(13-24)28-20/h7-8,10-11,16-20,24-27H,2-6,9,12-13H2,1H3 |
| InChIKey | KPVIZYXQTJLWIR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|