C29H31ClN2O10S — CID 18884447
[3,4,5-triacetyloxy-6-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 18884447) has the molecular formula C29H31ClN2O10S and a molecular weight of 635.09 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 18884447 |
| Molecular Formula | C29H31ClN2O10S |
| Molecular Weight | 635.09 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2nc3ccccc3n2CCOc2ccc(Cl)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H31ClN2O10S/c1-16(33)38-15-24-25(39-17(2)34)26(40-18(3)35)27(41-19(4)36)28(42-24)43-29-31-22-7-5-6-8-23(22)32(29)13-14-37-21-11-9-20(30)10-12-21/h5-12,24-28H,13-15H2,1-4H3 |
| InChIKey | JJUQPKAOMJRXHL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 141.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.09 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|