C33H40N2O10S — CID 18884423
[3,4,5-triacetyloxy-6-[1-[[2-(3-methylbutoxy)phenyl]methyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 18884423) has the molecular formula C33H40N2O10S and a molecular weight of 656.75 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[1-[[2-(3-methylbutoxy)phenyl]methyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[1-[[2-(3-methylbutoxy)phenyl]methyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 18884423 |
| Molecular Formula | C33H40N2O10S |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[1-[[2-(3-methylbutoxy)phenyl]methyl]benzimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2nc3ccccc3n2Cc2ccccc2OCCC(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C33H40N2O10S/c1-19(2)15-16-40-27-14-10-7-11-24(27)17-35-26-13-9-8-12-25(26)34-33(35)46-32-31(44-23(6)39)30(43-22(5)38)29(42-21(4)37)28(45-32)18-41-20(3)36/h7-14,19,28-32H,15-18H2,1-6H3 |
| InChIKey | GJUVUKDOXUVPRV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 141.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|