C26H31N3O10S — CID 51350219
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-morpholin-4-ylquinoxalin-2-yl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 51350219) has the molecular formula C26H31N3O10S and a molecular weight of 577.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-morpholin-4-ylquinoxalin-2-yl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-morpholin-4-ylquinoxalin-2-yl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51350219 |
| Molecular Formula | C26H31N3O10S |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-morpholin-4-ylquinoxalin-2-yl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2nc3ccccc3nc2N2CCOCC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H31N3O10S/c1-14(30)35-13-20-21(36-15(2)31)22(37-16(3)32)23(38-17(4)33)26(39-20)40-25-24(29-9-11-34-12-10-29)27-18-7-5-6-8-19(18)28-25/h5-8,20-23,26H,9-13H2,1-4H3/t20-,21-,22+,23-,26+/m1/s1 |
| InChIKey | XZDCYHXHTQZHMB-OPMJLWCUSA-N |
| XLogP | 1.64 |
| TPSA | 152.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|