C17H21N3O11S — CID 42339832
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 42339832) has the molecular formula C17H21N3O11S and a molecular weight of 475.43 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 42339832 |
| Molecular Formula | C17H21N3O11S |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2n[nH]c(=O)[nH]c2=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H21N3O11S/c1-6(21)27-5-10-11(28-7(2)22)12(29-8(3)23)13(30-9(4)24)16(31-10)32-15-14(25)18-17(26)20-19-15/h10-13,16H,5H2,1-4H3,(H2,18,20,25,26)/t10-,11-,12+,13+,16-/m1/s1 |
| InChIKey | PDDJQVOWAJDKPZ-XRMRDTNMSA-N |
| XLogP | -1.37 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|