C29H30N2O9S — CID 139231444
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methylphenyl)phthalazin-1-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 139231444) has the molecular formula C29H30N2O9S and a molecular weight of 582.63 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methylphenyl)phthalazin-1-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methylphenyl)phthalazin-1-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139231444 |
| Molecular Formula | C29H30N2O9S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methylphenyl)phthalazin-1-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2nnc(-c3ccc(C)cc3)c3ccccc23)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H30N2O9S/c1-15-10-12-20(13-11-15)24-21-8-6-7-9-22(21)28(31-30-24)41-29-27(39-19(5)35)26(38-18(4)34)25(37-17(3)33)23(40-29)14-36-16(2)32/h6-13,23,25-27,29H,14H2,1-5H3/t23-,25-,26+,27-,29+/m1/s1 |
| InChIKey | SYNMRVPXWRNYCC-LILOYGOGSA-N |
| XLogP | 3.78 |
| TPSA | 140.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|