C25H18FNO3 — CID 18887624
2-(2,4-dimethylanilino)-3-(3-fluorophenyl)furo[3,2-c]chromen-4-one (PubChem CID 18887624) has the molecular formula C25H18FNO3 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-3-(3-fluorophenyl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-(2,4-dimethylanilino)-3-(3-fluorophenyl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 18887624 |
| Molecular Formula | C25H18FNO3 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(2,4-dimethylanilino)-3-(3-fluorophenyl)furo[3,2-c]chromen-4-one |
| SMILES | Cc1ccc(Nc2oc3c(c2-c2cccc(F)c2)c(=O)oc2ccccc23)c(C)c1 |
| InChI | InChI=1S/C25H18FNO3/c1-14-10-11-19(15(2)12-14)27-24-21(16-6-5-7-17(26)13-16)22-23(30-24)18-8-3-4-9-20(18)29-25(22)28/h3-13,27H,1-2H3 |
| InChIKey | QIXIROLEYRDIBR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|