C24H21N3O5S — CID 18890435
N-benzyl-4-(4-ethylphenyl)sulfonyl-2-(3-nitrophenyl)-1,3-oxazol-5-amine (PubChem CID 18890435) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-benzyl-4-(4-ethylphenyl)sulfonyl-2-(3-nitrophenyl)-1,3-oxazol-5-amine.
| Compound Name | N-benzyl-4-(4-ethylphenyl)sulfonyl-2-(3-nitrophenyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18890435 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-benzyl-4-(4-ethylphenyl)sulfonyl-2-(3-nitrophenyl)-1,3-oxazol-5-amine |
| SMILES | CCc1ccc(S(=O)(=O)c2nc(-c3cccc([N+](=O)[O-])c3)oc2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-2-17-11-13-21(14-12-17)33(30,31)24-23(25-16-18-7-4-3-5-8-18)32-22(26-24)19-9-6-10-20(15-19)27(28)29/h3-15,25H,2,16H2,1H3 |
| InChIKey | WDBXROWIIYTVTD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|