C28H24N2O4S — CID 18890540
N-benzyl-4-(4-ethoxyphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-amine (PubChem CID 18890540) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-benzyl-4-(4-ethoxyphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-amine.
| Compound Name | N-benzyl-4-(4-ethoxyphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18890540 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-benzyl-4-(4-ethoxyphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-amine |
| SMILES | CCOc1ccc(S(=O)(=O)c2nc(-c3cccc4ccccc34)oc2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O4S/c1-2-33-22-15-17-23(18-16-22)35(31,32)28-27(29-19-20-9-4-3-5-10-20)34-26(30-28)25-14-8-12-21-11-6-7-13-24(21)25/h3-18,29H,2,19H2,1H3 |
| InChIKey | VOPPMIDNDWHWKT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |