C19H15ClFN3O3S — CID 18892602
4-chloro-N-[2-fluoro-4-(pyridin-4-ylmethylsulfamoyl)phenyl]benzamide (PubChem CID 18892602) has the molecular formula C19H15ClFN3O3S and a molecular weight of 419.87 g/mol. Its IUPAC name is 4-chloro-N-[2-fluoro-4-(pyridin-4-ylmethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-fluoro-4-(pyridin-4-ylmethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18892602 |
| Molecular Formula | C19H15ClFN3O3S |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-chloro-N-[2-fluoro-4-(pyridin-4-ylmethylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccncc2)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClFN3O3S/c20-15-3-1-14(2-4-15)19(25)24-18-6-5-16(11-17(18)21)28(26,27)23-12-13-7-9-22-10-8-13/h1-11,23H,12H2,(H,24,25) |
| InChIKey | UJEKMGSJMVTFQT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |