C24H21NO5S — CID 18894758
2-[[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18894758) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18894758 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-[[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccc(C(=O)CSc2cccc(NC(=O)c3ccccc3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H21NO5S/c1-2-30-18-12-10-16(11-13-18)22(26)15-31-19-7-5-6-17(14-19)25-23(27)20-8-3-4-9-21(20)24(28)29/h3-14H,2,15H2,1H3,(H,25,27)(H,28,29) |
| InChIKey | QQBVZXPOKXQDCZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |