C38H28Cl4N2O6S2 — CID 18897798
2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897798) has the molecular formula C38H28Cl4N2O6S2 and a molecular weight of 814.60 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897798 |
| Molecular Formula | C38H28Cl4N2O6S2 |
| Molecular Weight | 814.60 g/mol |
| Exact Mass | 812.01 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)c2ccccc2)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C38H28Cl4N2O6S2/c1-50-38(49)26-24-16-15-21(19-9-4-2-5-10-19)17-25(24)52-36(26)44-35(46)33(20-11-6-3-7-12-20)51-23-14-8-13-22(18-23)43-34(45)27-28(37(47)48)30(40)32(42)31(41)29(27)39/h2-14,18,21,33H,15-17H2,1H3,(H,43,45)(H,44,46)(H,47,48) |
| InChIKey | CCIUCFWRVRYAQF-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.60 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|