C32H23Cl4N3O4S2 — CID 18897790
2,3,4,5-tetrachloro-6-[[3-[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897790) has the molecular formula C32H23Cl4N3O4S2 and a molecular weight of 719.50 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897790 |
| Molecular Formula | C32H23Cl4N3O4S2 |
| Molecular Weight | 719.50 g/mol |
| Exact Mass | 716.99 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC1CCc2c(sc(NC(=O)C(Sc3cccc(NC(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C(=O)O)c3)c3ccccc3)c2C#N)C1 |
| InChI | InChI=1S/C32H23Cl4N3O4S2/c1-15-10-11-19-20(14-37)31(45-21(19)12-15)39-30(41)28(16-6-3-2-4-7-16)44-18-9-5-8-17(13-18)38-29(40)22-23(32(42)43)25(34)27(36)26(35)24(22)33/h2-9,13,15,28H,10-12H2,1H3,(H,38,40)(H,39,41)(H,42,43) |
| InChIKey | KDEBNCPFVRYGJV-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.50 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|