C25H32N2O3S — CID 18907748
N-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 18907748) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18907748 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C(CC)Sc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H32N2O3S/c1-3-23(25(29)27-21-15-8-9-16-22(21)30-4-2)31-20-14-10-13-19(17-20)26-24(28)18-11-6-5-7-12-18/h8-10,13-18,23H,3-7,11-12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | GOQHKGCOHRLJDN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |