About (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone
(5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone (PubChem CID 18915119) has the molecular formula C20H28N2OS
and a molecular weight of 344.52 g/mol. Its IUPAC name is (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone |
| PubChem CID | 18915119 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone |
| SMILES | Cc1ccc2c(c1)CCC2C(=O)N1CCSCC1CN1CCCC1 |
| InChI | InChI=1S/C20H28N2OS/c1-15-4-6-18-16(12-15)5-7-19(18)20(23)22-10-11-24-14-17(22)13-21-8-2-3-9-21/h4,6,12,17,19H,2-3,5,7-11,13-14H2,1H3 |
| InChIKey | OQTDBMRWRKMSQV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone?
The IUPAC name of (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone (CID 18915119) is (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone.
What is the SMILES notation for (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone?
The canonical SMILES for (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone is Cc1ccc2c(c1)CCC2C(=O)N1CCSCC1CN1CCCC1.
What is the InChIKey of (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone?
The InChIKey is OQTDBMRWRKMSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2OS/c1-15-4-6-18-16(12-15)5-7-19(18)20(23)22-10-11-24-14-17(22)13-21-8-2-3-9-21/h4,6,12,17,19H,2-3,5,7-11,13-14H2,1H3.
What are the key properties of (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone?
(5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone has a molecular weight of 344.52 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2,3-dihydro-1H-inden-1-yl)-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone is sourced from PubChem (CID 18915119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).