C11H21ClN2OS — CID 142636132
1-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]ethanone;hydrochloride (PubChem CID 142636132) has the molecular formula C11H21ClN2OS and a molecular weight of 264.82 g/mol. Its IUPAC name is 1-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]ethanone;hydrochloride.
| Compound Name | 1-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 142636132 |
| Molecular Formula | C11H21ClN2OS |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]ethanone;hydrochloride |
| SMILES | CC(=O)N1CCSCC1CN1CCCC1.Cl |
| InChI | InChI=1S/C11H20N2OS.ClH/c1-10(14)13-6-7-15-9-11(13)8-12-4-2-3-5-12;/h11H,2-9H2,1H3;1H |
| InChIKey | FZDQZSUMCXBNSX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |