C13H23ClN2OS — CID 90568416
2-chloro-1-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]propan-1-one (PubChem CID 90568416) has the molecular formula C13H23ClN2OS and a molecular weight of 290.86 g/mol. Its IUPAC name is 2-chloro-1-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]propan-1-one.
| Compound Name | 2-chloro-1-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 90568416 |
| Molecular Formula | C13H23ClN2OS |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-chloro-1-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCCSCC1CN1CCCC1 |
| InChI | InChI=1S/C13H23ClN2OS/c1-11(14)13(17)16-7-4-8-18-10-12(16)9-15-5-2-3-6-15/h11-12H,2-10H2,1H3 |
| InChIKey | YKVTWTXVPWJHDM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|