C13H26N2O2S2 — CID 90568667
4-propan-2-ylsulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane (PubChem CID 90568667) has the molecular formula C13H26N2O2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 4-propan-2-ylsulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-propan-2-ylsulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90568667 |
| Molecular Formula | C13H26N2O2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-propan-2-ylsulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane |
| SMILES | CC(C)S(=O)(=O)N1CCCSCC1CN1CCCC1 |
| InChI | InChI=1S/C13H26N2O2S2/c1-12(2)19(16,17)15-8-5-9-18-11-13(15)10-14-6-3-4-7-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | KTJAWQQENDSLFB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |