C12H24N2O2S2 — CID 71801837
4-methylsulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane (PubChem CID 71801837) has the molecular formula C12H24N2O2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-methylsulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-methylsulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 71801837 |
| Molecular Formula | C12H24N2O2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-methylsulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane |
| SMILES | CS(=O)(=O)N1CCCSCC1CN1CCCCC1 |
| InChI | InChI=1S/C12H24N2O2S2/c1-18(15,16)14-8-5-9-17-11-12(14)10-13-6-3-2-4-7-13/h12H,2-11H2,1H3 |
| InChIKey | RFACFQAVLAOCTE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |