C19H30N2O4S2 — CID 90569019
4-(3,4-dimethoxyphenyl)sulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane (PubChem CID 90569019) has the molecular formula C19H30N2O4S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)sulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-(3,4-dimethoxyphenyl)sulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90569019 |
| Molecular Formula | C19H30N2O4S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)sulfonyl-3-(piperidin-1-ylmethyl)-1,4-thiazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCSCC2CN2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H30N2O4S2/c1-24-18-8-7-17(13-19(18)25-2)27(22,23)21-11-6-12-26-15-16(21)14-20-9-4-3-5-10-20/h7-8,13,16H,3-6,9-12,14-15H2,1-2H3 |
| InChIKey | HUNVXGYKWMOHMS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |