C16H23ClN2O3S2 — CID 97105402
4-[[(3R)-4-(4-chlorophenyl)sulfonyl-1,4-thiazepan-3-yl]methyl]morpholine (PubChem CID 97105402) has the molecular formula C16H23ClN2O3S2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 4-[[(3R)-4-(4-chlorophenyl)sulfonyl-1,4-thiazepan-3-yl]methyl]morpholine.
| Compound Name | 4-[[(3R)-4-(4-chlorophenyl)sulfonyl-1,4-thiazepan-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 97105402 |
| Molecular Formula | C16H23ClN2O3S2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-[[(3R)-4-(4-chlorophenyl)sulfonyl-1,4-thiazepan-3-yl]methyl]morpholine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCCSC[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C16H23ClN2O3S2/c17-14-2-4-16(5-3-14)24(20,21)19-6-1-11-23-13-15(19)12-18-7-9-22-10-8-18/h2-5,15H,1,6-13H2/t15-/m1/s1 |
| InChIKey | YPABNPDIKXHBIA-OAHLLOKOSA-N |
| XLogP | 2.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |