C17H26N2O3S2 — CID 90568656
4-(3-methoxyphenyl)sulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane (PubChem CID 90568656) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)sulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-(3-methoxyphenyl)sulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90568656 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(3-methoxyphenyl)sulfonyl-3-(pyrrolidin-1-ylmethyl)-1,4-thiazepane |
| SMILES | COc1cccc(S(=O)(=O)N2CCCSCC2CN2CCCC2)c1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-22-16-6-4-7-17(12-16)24(20,21)19-10-5-11-23-14-15(19)13-18-8-2-3-9-18/h4,6-7,12,15H,2-3,5,8-11,13-14H2,1H3 |
| InChIKey | ANARCBZRDFTJBN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |