C19H18N2O2 — CID 18915549
1-(4-nitrophenyl)-N-[3-(2,4,5-trimethylphenyl)prop-2-ynyl]methanimine (PubChem CID 18915549) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[3-(2,4,5-trimethylphenyl)prop-2-ynyl]methanimine.
| Compound Name | 1-(4-nitrophenyl)-N-[3-(2,4,5-trimethylphenyl)prop-2-ynyl]methanimine |
|---|---|
| PubChem CID | 18915549 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[3-(2,4,5-trimethylphenyl)prop-2-ynyl]methanimine |
| SMILES | Cc1cc(C)c(C#CC/N=C/c2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C19H18N2O2/c1-14-11-16(3)18(12-15(14)2)5-4-10-20-13-17-6-8-19(9-7-17)21(22)23/h6-9,11-13H,10H2,1-3H3/b20-13+ |
| InChIKey | HHSWBWAZQMZKEN-DEDYPNTBSA-N |
| XLogP | 3.99 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|