C32H36N2O2 — CID 18916167
prop-2-enyl 4-[[N-benzyl-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]amino]benzoate (PubChem CID 18916167) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is prop-2-enyl 4-[[N-benzyl-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]amino]benzoate.
| Compound Name | prop-2-enyl 4-[[N-benzyl-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 18916167 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | prop-2-enyl 4-[[N-benzyl-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]amino]benzoate |
| SMILES | C=CCOC(=O)c1ccc(N/C(=N/Cc2ccccc2)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C32H36N2O2/c1-6-20-36-30(35)24-12-15-26(16-13-24)34-29(33-22-23-10-8-7-9-11-23)25-14-17-27-28(21-25)32(4,5)19-18-31(27,2)3/h6-17,21H,1,18-20,22H2,2-5H3,(H,33,34) |
| InChIKey | KIPOSMURRDVEEP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|