C13H11Cl2N — CID 18916594
2,3-bis(chloromethyl)-6-phenylpyridine (PubChem CID 18916594) has the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. Its IUPAC name is 2,3-bis(chloromethyl)-6-phenylpyridine.
| Compound Name | 2,3-bis(chloromethyl)-6-phenylpyridine |
|---|---|
| PubChem CID | 18916594 |
| Molecular Formula | C13H11Cl2N |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2,3-bis(chloromethyl)-6-phenylpyridine |
| SMILES | ClCc1ccc(-c2ccccc2)nc1CCl |
| InChI | InChI=1S/C13H11Cl2N/c14-8-11-6-7-12(16-13(11)9-15)10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | VFYORPJLYBMKIJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|