C10H7Cl2NSe — CID 139072612
5-chloro-4-(chloromethyl)-2-phenyl-1,3-selenazole (PubChem CID 139072612) has the molecular formula C10H7Cl2NSe and a molecular weight of 291.04 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2-phenyl-1,3-selenazole.
| Compound Name | 5-chloro-4-(chloromethyl)-2-phenyl-1,3-selenazole |
|---|---|
| PubChem CID | 139072612 |
| Molecular Formula | C10H7Cl2NSe |
| Molecular Weight | 291.04 g/mol |
| Exact Mass | 290.91 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2-phenyl-1,3-selenazole |
| SMILES | ClCc1nc(-c2ccccc2)[se]c1Cl |
| InChI | InChI=1S/C10H7Cl2NSe/c11-6-8-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | FHDHJSHYHNYZCU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.04 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|