C22H16FNSe2 — CID 135000849
4-[(4-fluorophenyl)methyl]-2-phenyl-5-phenylselanyl-1,3-selenazole (PubChem CID 135000849) has the molecular formula C22H16FNSe2 and a molecular weight of 471.30 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-2-phenyl-5-phenylselanyl-1,3-selenazole.
| Compound Name | 4-[(4-fluorophenyl)methyl]-2-phenyl-5-phenylselanyl-1,3-selenazole |
|---|---|
| PubChem CID | 135000849 |
| Molecular Formula | C22H16FNSe2 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-2-phenyl-5-phenylselanyl-1,3-selenazole |
| SMILES | Fc1ccc(Cc2nc(-c3ccccc3)[se]c2[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16FNSe2/c23-18-13-11-16(12-14-18)15-20-22(25-19-9-5-2-6-10-19)26-21(24-20)17-7-3-1-4-8-17/h1-14H,15H2 |
| InChIKey | JQMHCNIIVQDRIF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|