C20H26N4O3 — CID 18918214
methyl 2-amino-4-[4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate (PubChem CID 18918214) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 2-amino-4-[4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate.
| Compound Name | methyl 2-amino-4-[4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 18918214 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl 2-amino-4-[4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate |
| SMILES | COC(=O)C(N)CCOc1ccc(N2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-20(25)19(21)8-15-27-18-4-2-16(3-5-18)23-11-13-24(14-12-23)17-6-9-22-10-7-17/h2-7,9-10,19H,8,11-15,21H2,1H3 |
| InChIKey | GKXWYGXZGRSTGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|