C24H31N3O4 — CID 18918357
butyl 2-[4-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoyl]phenoxy]acetate (PubChem CID 18918357) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is butyl 2-[4-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoyl]phenoxy]acetate.
| Compound Name | butyl 2-[4-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 18918357 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | butyl 2-[4-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoyl]phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1ccc(C(=O)NCC2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-2-3-16-30-23(28)18-31-22-6-4-20(5-7-22)24(29)26-17-19-10-14-27(15-11-19)21-8-12-25-13-9-21/h4-9,12-13,19H,2-3,10-11,14-18H2,1H3,(H,26,29) |
| InChIKey | NCOJQRSQSBHWTQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|