C20H23N3O4 — CID 18918578
2-[2-methyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid (PubChem CID 18918578) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18918578 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[2-methyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid |
| SMILES | Cc1cc(C(=O)CN2CCN(c3ccncc3)CC2)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H23N3O4/c1-15-12-16(2-3-19(15)27-14-20(25)26)18(24)13-22-8-10-23(11-9-22)17-4-6-21-7-5-17/h2-7,12H,8-11,13-14H2,1H3,(H,25,26) |
| InChIKey | FUCJUZGOWHOPMU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |