C23H29N3O3 — CID 19030688
[2-tert-butyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenyl] acetate (PubChem CID 19030688) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is [2-tert-butyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenyl] acetate.
| Compound Name | [2-tert-butyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenyl] acetate |
|---|---|
| PubChem CID | 19030688 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [2-tert-butyl-4-[2-(4-pyridin-4-ylpiperazin-1-yl)acetyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)CN2CCN(c3ccncc3)CC2)cc1C(C)(C)C |
| InChI | InChI=1S/C23H29N3O3/c1-17(27)29-22-6-5-18(15-20(22)23(2,3)4)21(28)16-25-11-13-26(14-12-25)19-7-9-24-10-8-19/h5-10,15H,11-14,16H2,1-4H3 |
| InChIKey | TUFFCPIEJYCWCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|