About 2-phenylthiophen-3-amine
2-phenylthiophen-3-amine (PubChem CID 18925395) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 2-phenylthiophen-3-amine.
Molecular Properties
| Compound Name | 2-phenylthiophen-3-amine |
| PubChem CID | 18925395 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 2-phenylthiophen-3-amine |
| SMILES | Nc1ccsc1-c1ccccc1 |
| InChI | InChI=1S/C10H9NS/c11-9-6-7-12-10(9)8-4-2-1-3-5-8/h1-7H,11H2 |
| InChIKey | CRDIHPHMWBEZEO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylthiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylthiophen-3-amine?
The IUPAC name of 2-phenylthiophen-3-amine (CID 18925395) is 2-phenylthiophen-3-amine.
What is the SMILES notation for 2-phenylthiophen-3-amine?
The canonical SMILES for 2-phenylthiophen-3-amine is Nc1ccsc1-c1ccccc1.
What is the InChIKey of 2-phenylthiophen-3-amine?
The InChIKey is CRDIHPHMWBEZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c11-9-6-7-12-10(9)8-4-2-1-3-5-8/h1-7H,11H2.
What are the key properties of 2-phenylthiophen-3-amine?
2-phenylthiophen-3-amine has a molecular weight of 175.26 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylthiophen-3-amine is sourced from PubChem (CID 18925395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).