C25H23N3O3S — CID 18928951
N-[[3-(aminomethyl)phenyl]methyl]-3-(naphthalen-2-ylsulfonylamino)benzamide (PubChem CID 18928951) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-3-(naphthalen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-3-(naphthalen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 18928951 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-3-(naphthalen-2-ylsulfonylamino)benzamide |
| SMILES | NCc1cccc(CNC(=O)c2cccc(NS(=O)(=O)c3ccc4ccccc4c3)c2)c1 |
| InChI | InChI=1S/C25H23N3O3S/c26-16-18-5-3-6-19(13-18)17-27-25(29)22-9-4-10-23(14-22)28-32(30,31)24-12-11-20-7-1-2-8-21(20)15-24/h1-15,28H,16-17,26H2,(H,27,29) |
| InChIKey | GELVZOBPTXXHOU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |