About (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride
(1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride (PubChem CID 18930053) has the molecular formula C24H22ClNO2
and a molecular weight of 391.90 g/mol. Its IUPAC name is (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride.
Molecular Properties
| Compound Name | (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride |
| PubChem CID | 18930053 |
| Molecular Formula | C24H22ClNO2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride |
| SMILES | CO/N=C(\Cl)c1ccccc1COc1ccc(C2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22ClNO2/c1-27-26-24(25)23-9-5-3-7-19(23)16-28-20-13-10-18(11-14-20)22-15-12-17-6-2-4-8-21(17)22/h2-11,13-14,22H,12,15-16H2,1H3/b26-24- |
| InChIKey | XNUVRWMWAHHRMJ-LCUIJRPUSA-N |
| XLogP | 5.89 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride?
The IUPAC name of (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride (CID 18930053) is (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride.
What is the SMILES notation for (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride?
The canonical SMILES for (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride is CO/N=C(\Cl)c1ccccc1COc1ccc(C2CCc3ccccc32)cc1.
What is the InChIKey of (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride?
The InChIKey is XNUVRWMWAHHRMJ-LCUIJRPUSA-N. The full InChI is InChI=1S/C24H22ClNO2/c1-27-26-24(25)23-9-5-3-7-19(23)16-28-20-13-10-18(11-14-20)22-15-12-17-6-2-4-8-21(17)22/h2-11,13-14,22H,12,15-16H2,1H3/b26-24-.
What are the key properties of (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride?
(1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride has a molecular weight of 391.90 g/mol, XLogP of 5.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-[[4-(2,3-dihydro-1H-inden-1-yl)phenoxy]methyl]-N-methoxybenzenecarboximidoyl chloride is sourced from PubChem (CID 18930053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).