C17H20N4O4S — CID 18930160
N-(diaminomethylidene)-4-(3-methoxyanilino)-2-methyl-5-methylsulfonylbenzamide (PubChem CID 18930160) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(3-methoxyanilino)-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-(3-methoxyanilino)-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18930160 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(diaminomethylidene)-4-(3-methoxyanilino)-2-methyl-5-methylsulfonylbenzamide |
| SMILES | COc1cccc(Nc2cc(C)c(C(=O)N=C(N)N)cc2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H20N4O4S/c1-10-7-14(20-11-5-4-6-12(8-11)25-2)15(26(3,23)24)9-13(10)16(22)21-17(18)19/h4-9,20H,1-3H3,(H4,18,19,21,22) |
| InChIKey | PCTIYBSPOBOZHQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|