C29H31N3O5 — CID 18930576
tert-butyl 2-(2-benzoyl-N-[2-[(3-methylphenyl)carbamoylamino]acetyl]anilino)acetate (PubChem CID 18930576) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl 2-(2-benzoyl-N-[2-[(3-methylphenyl)carbamoylamino]acetyl]anilino)acetate.
| Compound Name | tert-butyl 2-(2-benzoyl-N-[2-[(3-methylphenyl)carbamoylamino]acetyl]anilino)acetate |
|---|---|
| PubChem CID | 18930576 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | tert-butyl 2-(2-benzoyl-N-[2-[(3-methylphenyl)carbamoylamino]acetyl]anilino)acetate |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N(CC(=O)OC(C)(C)C)c2ccccc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H31N3O5/c1-20-11-10-14-22(17-20)31-28(36)30-18-25(33)32(19-26(34)37-29(2,3)4)24-16-9-8-15-23(24)27(35)21-12-6-5-7-13-21/h5-17H,18-19H2,1-4H3,(H2,30,31,36) |
| InChIKey | YVCNBLQLZKWKOI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |