C30H28N4O3 — CID 18930664
N-[(3-aminophenyl)methyl]-N-(2-benzoylphenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide (PubChem CID 18930664) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-N-(2-benzoylphenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide.
| Compound Name | N-[(3-aminophenyl)methyl]-N-(2-benzoylphenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 18930664 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-N-(2-benzoylphenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N(Cc2cccc(N)c2)c2ccccc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H28N4O3/c1-21-9-7-14-25(17-21)33-30(37)32-19-28(35)34(20-22-10-8-13-24(31)18-22)27-16-6-5-15-26(27)29(36)23-11-3-2-4-12-23/h2-18H,19-20,31H2,1H3,(H2,32,33,37) |
| InChIKey | DJYSUNYYEHNVHR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|