C9H22N2O2 — CID 18933421
N,N'-bis(1-methoxyethyl)propane-1,3-diamine (PubChem CID 18933421) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N,N'-bis(1-methoxyethyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(1-methoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 18933421 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | N,N'-bis(1-methoxyethyl)propane-1,3-diamine |
| SMILES | COC(C)NCCCNC(C)OC |
| InChI | InChI=1S/C9H22N2O2/c1-8(12-3)10-6-5-7-11-9(2)13-4/h8-11H,5-7H2,1-4H3 |
| InChIKey | FOCPXPLFYUUSIE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|