C15H21N3OS — CID 18934859
4,4-dipropyl-2-(pyridin-2-ylmethylsulfanyl)-1H-imidazol-5-one (PubChem CID 18934859) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 4,4-dipropyl-2-(pyridin-2-ylmethylsulfanyl)-1H-imidazol-5-one.
| Compound Name | 4,4-dipropyl-2-(pyridin-2-ylmethylsulfanyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 18934859 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4,4-dipropyl-2-(pyridin-2-ylmethylsulfanyl)-1H-imidazol-5-one |
| SMILES | CCCC1(CCC)N=C(SCc2ccccn2)NC1=O |
| InChI | InChI=1S/C15H21N3OS/c1-3-8-15(9-4-2)13(19)17-14(18-15)20-11-12-7-5-6-10-16-12/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,17,18,19) |
| InChIKey | GGIHXTRXYFKWNR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |