C12H7ClF5NS — CID 12760224
2-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]pyridine;hydrochloride (PubChem CID 12760224) has the molecular formula C12H7ClF5NS and a molecular weight of 327.71 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]pyridine;hydrochloride.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]pyridine;hydrochloride |
|---|---|
| PubChem CID | 12760224 |
| Molecular Formula | C12H7ClF5NS |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]pyridine;hydrochloride |
| SMILES | Cl.Fc1c(F)c(F)c(SCc2ccccn2)c(F)c1F |
| InChI | InChI=1S/C12H6F5NS.ClH/c13-7-8(14)10(16)12(11(17)9(7)15)19-5-6-3-1-2-4-18-6;/h1-4H,5H2;1H |
| InChIKey | MUDBSTNZZWRUSH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|