C14H15NS — CID 52562461
2-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine (PubChem CID 52562461) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 52562461 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine |
| SMILES | Cc1ccc(C)c(SCc2ccccn2)c1 |
| InChI | InChI=1S/C14H15NS/c1-11-6-7-12(2)14(9-11)16-10-13-5-3-4-8-15-13/h3-9H,10H2,1-2H3 |
| InChIKey | BSFSIEDRPOBWRE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |