C14H14ClNS — CID 79040235
2-chloro-6-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine (PubChem CID 79040235) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 2-chloro-6-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-6-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 79040235 |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-chloro-6-[(2,5-dimethylphenyl)sulfanylmethyl]pyridine |
| SMILES | Cc1ccc(C)c(SCc2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C14H14ClNS/c1-10-6-7-11(2)13(8-10)17-9-12-4-3-5-14(15)16-12/h3-8H,9H2,1-2H3 |
| InChIKey | AUDVKEUBXQBVKG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|