C9H9ClN4S — CID 104588089
2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine (PubChem CID 104588089) has the molecular formula C9H9ClN4S and a molecular weight of 240.72 g/mol. Its IUPAC name is 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 104588089 |
| Molecular Formula | C9H9ClN4S |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
| SMILES | Cn1ncnc1SCc1cccc(Cl)n1 |
| InChI | InChI=1S/C9H9ClN4S/c1-14-9(11-6-12-14)15-5-7-3-2-4-8(10)13-7/h2-4,6H,5H2,1H3 |
| InChIKey | HAFRTMLLTDTHIE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|