C6H10ClN3OS — CID 104602645
1-chloro-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol (PubChem CID 104602645) has the molecular formula C6H10ClN3OS and a molecular weight of 207.69 g/mol. Its IUPAC name is 1-chloro-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol.
| Compound Name | 1-chloro-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 104602645 |
| Molecular Formula | C6H10ClN3OS |
| Molecular Weight | 207.69 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 1-chloro-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-ol |
| SMILES | Cn1ncnc1SCC(O)CCl |
| InChI | InChI=1S/C6H10ClN3OS/c1-10-6(8-4-9-10)12-3-5(11)2-7/h4-5,11H,2-3H2,1H3 |
| InChIKey | WGWAOQASPAWTNA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.69 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|