C7H12BrN3S — CID 104602649
5-(3-bromo-2-methylpropyl)sulfanyl-1-methyl-1,2,4-triazole (PubChem CID 104602649) has the molecular formula C7H12BrN3S and a molecular weight of 250.16 g/mol. Its IUPAC name is 5-(3-bromo-2-methylpropyl)sulfanyl-1-methyl-1,2,4-triazole.
| Compound Name | 5-(3-bromo-2-methylpropyl)sulfanyl-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 104602649 |
| Molecular Formula | C7H12BrN3S |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 5-(3-bromo-2-methylpropyl)sulfanyl-1-methyl-1,2,4-triazole |
| SMILES | CC(CBr)CSc1ncnn1C |
| InChI | InChI=1S/C7H12BrN3S/c1-6(3-8)4-12-7-9-5-10-11(7)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | TWQUIWFTSPRMIY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|