C9H17N3S2 — CID 104604845
3-methyl-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentane-1-thiol (PubChem CID 104604845) has the molecular formula C9H17N3S2 and a molecular weight of 231.39 g/mol. Its IUPAC name is 3-methyl-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentane-1-thiol.
| Compound Name | 3-methyl-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentane-1-thiol |
|---|---|
| PubChem CID | 104604845 |
| Molecular Formula | C9H17N3S2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-methyl-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentane-1-thiol |
| SMILES | CC(CCS)CCSc1ncnn1C |
| InChI | InChI=1S/C9H17N3S2/c1-8(3-5-13)4-6-14-9-10-7-11-12(9)2/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | GPUHJPOKDVDNCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|