About 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole
5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole (PubChem CID 131176601) has the molecular formula C5H7F2N3S
and a molecular weight of 179.20 g/mol. Its IUPAC name is 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole.
Analyze 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole?
The IUPAC name of 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole (CID 131176601) is 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole.
What is the SMILES notation for 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole?
The canonical SMILES for 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole is Cn1ncnc1SCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole?
The InChIKey is CXUMNNAAICRZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3S/c1-10-5(8-3-9-10)11-2-4(6)7/h3-4H,2H2,1H3.
What are the key properties of 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole?
5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole has a molecular weight of 179.20 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethylsulfanyl)-1-methyl-1,2,4-triazole is sourced from PubChem (CID 131176601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).