About 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol
1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol (PubChem CID 104603692) has the molecular formula C10H19N5OS
and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol |
| PubChem CID | 104603692 |
| Molecular Formula | C10H19N5OS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol |
| SMILES | Cn1ncnc1SCC(O)CN1CCNCC1 |
| InChI | InChI=1S/C10H19N5OS/c1-14-10(12-8-13-14)17-7-9(16)6-15-4-2-11-3-5-15/h8-9,11,16H,2-7H2,1H3 |
| InChIKey | MSIPRYHDNBTIMC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol?
The IUPAC name of 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol (CID 104603692) is 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol.
What is the SMILES notation for 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol?
The canonical SMILES for 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol is Cn1ncnc1SCC(O)CN1CCNCC1.
What is the InChIKey of 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol?
The InChIKey is MSIPRYHDNBTIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5OS/c1-14-10(12-8-13-14)17-7-9(16)6-15-4-2-11-3-5-15/h8-9,11,16H,2-7H2,1H3.
What are the key properties of 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol?
1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol has a molecular weight of 257.36 g/mol, XLogP of -0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-piperazin-1-ylpropan-2-ol is sourced from PubChem (CID 104603692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).